C34H44O3 — CID 88968209
(E)-3-ethyl-1-[2-methyl-4-[3-[4-[2-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol (PubChem CID 88968209) has the molecular formula C34H44O3 and a molecular weight of 500.72 g/mol. Its IUPAC name is (E)-3-ethyl-1-[2-methyl-4-[3-[4-[2-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol.
| Compound Name | (E)-3-ethyl-1-[2-methyl-4-[3-[4-[2-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 88968209 |
| Molecular Formula | C34H44O3 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | (E)-3-ethyl-1-[2-methyl-4-[3-[4-[2-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol |
| SMILES | CCC(O)(/C=C/c1ccc(C(CC)(CC)c2ccc(-c3ccccc3CCOOC)cc2)cc1C)CC |
| InChI | InChI=1S/C34H44O3/c1-7-33(35,8-2)23-21-27-15-20-31(25-26(27)5)34(9-3,10-4)30-18-16-29(17-19-30)32-14-12-11-13-28(32)22-24-37-36-6/h11-21,23,25,35H,7-10,22,24H2,1-6H3/b23-21+ |
| InChIKey | VMODCTYYFGSGTP-XTQSDGFTSA-N |
| XLogP | 8.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|