C35H47NO3 — CID 88968155
(E)-3-ethyl-1-[4-[3-[4-[5-(2-ethylperoxyethyl)-2-pyridinyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl]pent-1-en-3-ol (PubChem CID 88968155) has the molecular formula C35H47NO3 and a molecular weight of 529.77 g/mol. Its IUPAC name is (E)-3-ethyl-1-[4-[3-[4-[5-(2-ethylperoxyethyl)-2-pyridinyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl]pent-1-en-3-ol.
| Compound Name | (E)-3-ethyl-1-[4-[3-[4-[5-(2-ethylperoxyethyl)-2-pyridinyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 88968155 |
| Molecular Formula | C35H47NO3 |
| Molecular Weight | 529.77 g/mol |
| Exact Mass | 529.36 |
| IUPAC Name | (E)-3-ethyl-1-[4-[3-[4-[5-(2-ethylperoxyethyl)-2-pyridinyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl]pent-1-en-3-ol |
| SMILES | CCOOCCc1ccc(-c2ccc(C(CC)(CC)c3ccc(/C=C/C(O)(CC)CC)c(C)c3)cc2C)nc1 |
| InChI | InChI=1S/C35H47NO3/c1-8-34(37,9-2)21-19-29-14-15-30(23-26(29)6)35(10-3,11-4)31-16-17-32(27(7)24-31)33-18-13-28(25-36-33)20-22-39-38-12-5/h13-19,21,23-25,37H,8-12,20,22H2,1-7H3/b21-19+ |
| InChIKey | NNXPMCZCXFSRQX-XUTLUUPISA-N |
| XLogP | 8.55 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.77 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|