C32H47BO3 — CID 67065065
3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol (PubChem CID 67065065) has the molecular formula C32H47BO3 and a molecular weight of 490.54 g/mol. Its IUPAC name is 3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol.
| Compound Name | 3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 67065065 |
| Molecular Formula | C32H47BO3 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | 3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol |
| SMILES | CCC(O)(C=Cc1ccc(C(CC)(CC)c2ccc(B3OC(C)(C)C(C)(C)O3)c(C)c2)cc1C)CC |
| InChI | InChI=1S/C32H47BO3/c1-11-31(34,12-2)20-19-25-15-16-26(21-23(25)5)32(13-3,14-4)27-17-18-28(24(6)22-27)33-35-29(7,8)30(9,10)36-33/h15-22,34H,11-14H2,1-10H3 |
| InChIKey | KWGGIHZKGNXKET-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|