C33H49B2O2 — CID 89288793
CID 89288793 (PubChem CID 89288793) has the molecular formula C33H49B2O2 and a molecular weight of 499.38 g/mol.
| Compound Name | CID 89288793 |
|---|---|
| PubChem CID | 89288793 |
| Molecular Formula | C33H49B2O2 |
| Molecular Weight | 499.38 g/mol |
| Exact Mass | 499.39 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)C(C)(C)O[B]c1c(C)cc(C(CC)(CC)c2ccc(/C=C/C(O)(CC)CC)c(C)c2)cc1C |
| InChI | InChI=1S/C33H49B2O2/c1-12-32(36,13-2)19-18-26-16-17-27(20-23(26)5)33(14-3,15-4)28-21-24(6)29(25(7)22-28)35-37-31(10,11)30(8,9)34/h16-22,36H,12-15H2,1-11H3/b19-18+ |
| InChIKey | CKAZVBXKUZERHV-VHEBQXMUSA-N |
| XLogP | 7.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.38 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|