C30H44O2 — CID 58598583
4-[3-[4-[(E)-3-ethyl-3-hydroxynon-1-enyl]-3-methylphenyl]pentan-3-yl]-2-methylphenol (PubChem CID 58598583) has the molecular formula C30H44O2 and a molecular weight of 436.68 g/mol. Its IUPAC name is 4-[3-[4-[(E)-3-ethyl-3-hydroxynon-1-enyl]-3-methylphenyl]pentan-3-yl]-2-methylphenol.
| Compound Name | 4-[3-[4-[(E)-3-ethyl-3-hydroxynon-1-enyl]-3-methylphenyl]pentan-3-yl]-2-methylphenol |
|---|---|
| PubChem CID | 58598583 |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | 4-[3-[4-[(E)-3-ethyl-3-hydroxynon-1-enyl]-3-methylphenyl]pentan-3-yl]-2-methylphenol |
| SMILES | CCCCCCC(O)(/C=C/c1ccc(C(CC)(CC)c2ccc(O)c(C)c2)cc1C)CC |
| InChI | InChI=1S/C30H44O2/c1-7-11-12-13-19-29(32,8-2)20-18-25-14-15-26(21-23(25)5)30(9-3,10-4)27-16-17-28(31)24(6)22-27/h14-18,20-22,31-32H,7-13,19H2,1-6H3/b20-18+ |
| InChIKey | NMNCCUHTFZEEFM-CZIZESTLSA-N |
| XLogP | 8.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|