C30H43BO5 — CID 143366245
5-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenoxy]pentanoic acid (PubChem CID 143366245) has the molecular formula C30H43BO5 and a molecular weight of 494.48 g/mol. Its IUPAC name is 5-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenoxy]pentanoic acid.
| Compound Name | 5-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 143366245 |
| Molecular Formula | C30H43BO5 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | 5-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenoxy]pentanoic acid |
| SMILES | CCC(CC)(c1ccc(OCCCCC(=O)O)c(C)c1)c1ccc(B2OC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C30H43BO5/c1-9-30(10-2,24-15-17-26(22(4)20-24)34-18-12-11-13-27(32)33)23-14-16-25(21(3)19-23)31-35-28(5,6)29(7,8)36-31/h14-17,19-20H,9-13,18H2,1-8H3,(H,32,33) |
| InChIKey | XDXGNJIQBKGXFI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|