C34H47BO2 — CID 58184106
4,4,5,5-tetramethyl-2-[2-methyl-4-[3-[3-methyl-4-[2-(1-methylcyclohexyl)ethynyl]phenyl]pentan-3-yl]phenyl]-1,3,2-dioxaborolane (PubChem CID 58184106) has the molecular formula C34H47BO2 and a molecular weight of 498.56 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2-methyl-4-[3-[3-methyl-4-[2-(1-methylcyclohexyl)ethynyl]phenyl]pentan-3-yl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2-methyl-4-[3-[3-methyl-4-[2-(1-methylcyclohexyl)ethynyl]phenyl]pentan-3-yl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58184106 |
| Molecular Formula | C34H47BO2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2-methyl-4-[3-[3-methyl-4-[2-(1-methylcyclohexyl)ethynyl]phenyl]pentan-3-yl]phenyl]-1,3,2-dioxaborolane |
| SMILES | CCC(CC)(c1ccc(C#CC2(C)CCCCC2)c(C)c1)c1ccc(B2OC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C34H47BO2/c1-10-34(11-2,28-16-15-27(25(3)23-28)19-22-33(9)20-13-12-14-21-33)29-17-18-30(26(4)24-29)35-36-31(5,6)32(7,8)37-35/h15-18,23-24H,10-14,20-21H2,1-9H3 |
| InChIKey | BVCZXUATQROZQY-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|