C31H45BO3 — CID 143366157
1-[(E)-2-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]cyclobuta-1,3-dien-1-yl]ethenyl]cyclohexan-1-ol (PubChem CID 143366157) has the molecular formula C31H45BO3 and a molecular weight of 476.51 g/mol. Its IUPAC name is 1-[(E)-2-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]cyclobuta-1,3-dien-1-yl]ethenyl]cyclohexan-1-ol.
| Compound Name | 1-[(E)-2-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]cyclobuta-1,3-dien-1-yl]ethenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143366157 |
| Molecular Formula | C31H45BO3 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.35 |
| IUPAC Name | 1-[(E)-2-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]cyclobuta-1,3-dien-1-yl]ethenyl]cyclohexan-1-ol |
| SMILES | CCC(CC)(C1=CC(C)=C1/C=C/C1(O)CCCCC1)c1ccc(B2OC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C31H45BO3/c1-9-31(10-2,26-21-22(3)25(26)16-19-30(33)17-12-11-13-18-30)24-14-15-27(23(4)20-24)32-34-28(5,6)29(7,8)35-32/h14-16,19-21,33H,9-13,17-18H2,1-8H3/b19-16+ |
| InChIKey | OGKGNZUKFNYGHM-KNTRCKAVSA-N |
| XLogP | 6.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|