C38H50O3Si — CID 88968232
trimethyl-[1-[2-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]ethynyl]cyclopentyl]oxysilane (PubChem CID 88968232) has the molecular formula C38H50O3Si and a molecular weight of 582.90 g/mol. Its IUPAC name is trimethyl-[1-[2-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]ethynyl]cyclopentyl]oxysilane.
| Compound Name | trimethyl-[1-[2-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]ethynyl]cyclopentyl]oxysilane |
|---|---|
| PubChem CID | 88968232 |
| Molecular Formula | C38H50O3Si |
| Molecular Weight | 582.90 g/mol |
| Exact Mass | 582.35 |
| IUPAC Name | trimethyl-[1-[2-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]ethynyl]cyclopentyl]oxysilane |
| SMILES | CCC(CC)(c1ccc(C#CC2(O[Si](C)(C)C)CCCC2)c(C)c1)c1ccc(-c2ccc(CCOOC)cc2)c(C)c1 |
| InChI | InChI=1S/C38H50O3Si/c1-9-38(10-2,35-19-20-36(30(4)28-35)33-15-13-31(14-16-33)22-26-40-39-5)34-18-17-32(29(3)27-34)21-25-37(23-11-12-24-37)41-42(6,7)8/h13-20,27-28H,9-12,22-24,26H2,1-8H3 |
| InChIKey | ULVPCHZNDHRQEJ-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.90 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|