C36H47NO2Si — CID 58183965
[4-[2-[4-[3-[4-(5-ethyl-3-pyridinyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]ethynyl]oxan-4-yl]oxy-trimethylsilane (PubChem CID 58183965) has the molecular formula C36H47NO2Si and a molecular weight of 553.86 g/mol. Its IUPAC name is [4-[2-[4-[3-[4-(5-ethyl-3-pyridinyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]ethynyl]oxan-4-yl]oxy-trimethylsilane.
| Compound Name | [4-[2-[4-[3-[4-(5-ethyl-3-pyridinyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]ethynyl]oxan-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 58183965 |
| Molecular Formula | C36H47NO2Si |
| Molecular Weight | 553.86 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | [4-[2-[4-[3-[4-(5-ethyl-3-pyridinyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]ethynyl]oxan-4-yl]oxy-trimethylsilane |
| SMILES | CCc1cncc(-c2ccc(C(CC)(CC)c3ccc(C#CC4(O[Si](C)(C)C)CCOCC4)c(C)c3)cc2C)c1 |
| InChI | InChI=1S/C36H47NO2Si/c1-9-29-24-31(26-37-25-29)34-15-14-33(23-28(34)5)36(10-2,11-3)32-13-12-30(27(4)22-32)16-17-35(39-40(6,7)8)18-20-38-21-19-35/h12-15,22-26H,9-11,18-21H2,1-8H3 |
| InChIKey | UITRVPISVMHMSF-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.86 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|