C37H49NO4Si — CID 88968159
trimethyl-[4-[2-[2-methyl-4-[3-[3-methyl-4-[5-(2-methylperoxyethyl)-3-pyridinyl]phenyl]pentan-3-yl]phenyl]ethynyl]oxan-4-yl]oxysilane (PubChem CID 88968159) has the molecular formula C37H49NO4Si and a molecular weight of 599.89 g/mol. Its IUPAC name is trimethyl-[4-[2-[2-methyl-4-[3-[3-methyl-4-[5-(2-methylperoxyethyl)-3-pyridinyl]phenyl]pentan-3-yl]phenyl]ethynyl]oxan-4-yl]oxysilane.
| Compound Name | trimethyl-[4-[2-[2-methyl-4-[3-[3-methyl-4-[5-(2-methylperoxyethyl)-3-pyridinyl]phenyl]pentan-3-yl]phenyl]ethynyl]oxan-4-yl]oxysilane |
|---|---|
| PubChem CID | 88968159 |
| Molecular Formula | C37H49NO4Si |
| Molecular Weight | 599.89 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | trimethyl-[4-[2-[2-methyl-4-[3-[3-methyl-4-[5-(2-methylperoxyethyl)-3-pyridinyl]phenyl]pentan-3-yl]phenyl]ethynyl]oxan-4-yl]oxysilane |
| SMILES | CCC(CC)(c1ccc(C#CC2(O[Si](C)(C)C)CCOCC2)c(C)c1)c1ccc(-c2cncc(CCOOC)c2)c(C)c1 |
| InChI | InChI=1S/C37H49NO4Si/c1-9-37(10-2,34-13-14-35(29(4)24-34)32-25-30(26-38-27-32)16-20-41-39-5)33-12-11-31(28(3)23-33)15-17-36(42-43(6,7)8)18-21-40-22-19-36/h11-14,23-27H,9-10,16,18-22H2,1-8H3 |
| InChIKey | YONAJFUFSZAFLH-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.89 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|