C16H26NO+ — CID 2246495
1-[4-(3,5-dimethylphenoxy)butyl]pyrrolidin-1-ium (PubChem CID 2246495) has the molecular formula C16H26NO+ and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylphenoxy)butyl]pyrrolidin-1-ium.
| Compound Name | 1-[4-(3,5-dimethylphenoxy)butyl]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 2246495 |
| Molecular Formula | C16H26NO+ |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-[4-(3,5-dimethylphenoxy)butyl]pyrrolidin-1-ium |
| SMILES | Cc1cc(C)cc(OCCCC[NH+]2CCCC2)c1 |
| InChI | InChI=1S/C16H25NO/c1-14-11-15(2)13-16(12-14)18-10-6-5-9-17-7-3-4-8-17/h11-13H,3-10H2,1-2H3/p+1 |
| InChIKey | YCYPWNGVPHGUEJ-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|