C17H27N2O2+ — CID 9443317
1-[3-(3,5-dimethylphenoxy)propyl]piperidin-1-ium-4-carboxamide (PubChem CID 9443317) has the molecular formula C17H27N2O2+ and a molecular weight of 291.41 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylphenoxy)propyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[3-(3,5-dimethylphenoxy)propyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9443317 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 1-[3-(3,5-dimethylphenoxy)propyl]piperidin-1-ium-4-carboxamide |
| SMILES | Cc1cc(C)cc(OCCC[NH+]2CCC(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C17H26N2O2/c1-13-10-14(2)12-16(11-13)21-9-3-6-19-7-4-15(5-8-19)17(18)20/h10-12,15H,3-9H2,1-2H3,(H2,18,20)/p+1 |
| InChIKey | PWPYSXCJAUPBFG-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|