C23H33NO — CID 7377531
(3R,5S)-3,5-dimethyl-1-(6-naphthalen-1-yloxyhexyl)piperidine (PubChem CID 7377531) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyl-1-(6-naphthalen-1-yloxyhexyl)piperidine.
| Compound Name | (3R,5S)-3,5-dimethyl-1-(6-naphthalen-1-yloxyhexyl)piperidine |
|---|---|
| PubChem CID | 7377531 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (3R,5S)-3,5-dimethyl-1-(6-naphthalen-1-yloxyhexyl)piperidine |
| SMILES | C[C@@H]1C[C@H](C)CN(CCCCCCOc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C23H33NO/c1-19-16-20(2)18-24(17-19)14-7-3-4-8-15-25-23-13-9-11-21-10-5-6-12-22(21)23/h5-6,9-13,19-20H,3-4,7-8,14-18H2,1-2H3/t19-,20+ |
| InChIKey | PURCLIABRYQFOP-BGYRXZFFSA-N |
| XLogP | 5.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|