C17H27ClFNO — CID 44655913
1-[4-(4-fluorophenoxy)butyl]-3,5-dimethylpiperidin-1-ium chloride (PubChem CID 44655913) has the molecular formula C17H27ClFNO and a molecular weight of 315.86 g/mol. Its IUPAC name is 1-[4-(4-fluorophenoxy)butyl]-3,5-dimethylpiperidin-1-ium chloride.
| Compound Name | 1-[4-(4-fluorophenoxy)butyl]-3,5-dimethylpiperidin-1-ium chloride |
|---|---|
| PubChem CID | 44655913 |
| Molecular Formula | C17H27ClFNO |
| Molecular Weight | 315.86 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-[4-(4-fluorophenoxy)butyl]-3,5-dimethylpiperidin-1-ium chloride |
| SMILES | CC1CC(C)C[NH+](CCCCOc2ccc(F)cc2)C1.[Cl-] |
| InChI | InChI=1S/C17H26FNO.ClH/c1-14-11-15(2)13-19(12-14)9-3-4-10-20-17-7-5-16(18)6-8-17;/h5-8,14-15H,3-4,9-13H2,1-2H3;1H |
| InChIKey | XNJXKGXTLJXQPU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.86 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|