C16H23ClNO3+ — CID 7380001
5-chloro-2-[3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]propoxy]benzaldehyde (PubChem CID 7380001) has the molecular formula C16H23ClNO3+ and a molecular weight of 312.82 g/mol. Its IUPAC name is 5-chloro-2-[3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]propoxy]benzaldehyde.
| Compound Name | 5-chloro-2-[3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]propoxy]benzaldehyde |
|---|---|
| PubChem CID | 7380001 |
| Molecular Formula | C16H23ClNO3+ |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-chloro-2-[3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]propoxy]benzaldehyde |
| SMILES | C[C@@H]1C[NH+](CCCOc2ccc(Cl)cc2C=O)C[C@@H](C)O1 |
| InChI | InChI=1S/C16H22ClNO3/c1-12-9-18(10-13(2)21-12)6-3-7-20-16-5-4-15(17)8-14(16)11-19/h4-5,8,11-13H,3,6-7,9-10H2,1-2H3/p+1/t12-,13-/m1/s1 |
| InChIKey | QBYARGRXOGBJLA-CHWSQXEVSA-O |
| XLogP | 1.61 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|