C17H22Cl3N2O2+ — CID 7031946
(E)-3-phenyl-N-[(1S)-2,2,2-trichloro-1-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]prop-2-enamide (PubChem CID 7031946) has the molecular formula C17H22Cl3N2O2+ and a molecular weight of 392.73 g/mol. Its IUPAC name is (E)-3-phenyl-N-[(1S)-2,2,2-trichloro-1-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[(1S)-2,2,2-trichloro-1-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 7031946 |
| Molecular Formula | C17H22Cl3N2O2+ |
| Molecular Weight | 392.73 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | (E)-3-phenyl-N-[(1S)-2,2,2-trichloro-1-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]prop-2-enamide |
| SMILES | C[C@H]1C[NH+]([C@H](NC(=O)/C=C/c2ccccc2)C(Cl)(Cl)Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C17H21Cl3N2O2/c1-12-10-22(11-13(2)24-12)16(17(18,19)20)21-15(23)9-8-14-6-4-3-5-7-14/h3-9,12-13,16H,10-11H2,1-2H3,(H,21,23)/p+1/b9-8+/t12-,13-,16-/m0/s1 |
| InChIKey | KLADKBTYRMALAX-CTEHBZJOSA-O |
| XLogP | 2.20 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|