C19H19Cl3N2O — CID 21177421
(Z)-3-phenyl-N-[2,2,2-trichloro-1-(2-phenylethylamino)ethyl]prop-2-enamide (PubChem CID 21177421) has the molecular formula C19H19Cl3N2O and a molecular weight of 397.73 g/mol. Its IUPAC name is (Z)-3-phenyl-N-[2,2,2-trichloro-1-(2-phenylethylamino)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-phenyl-N-[2,2,2-trichloro-1-(2-phenylethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 21177421 |
| Molecular Formula | C19H19Cl3N2O |
| Molecular Weight | 397.73 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (Z)-3-phenyl-N-[2,2,2-trichloro-1-(2-phenylethylamino)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C\c1ccccc1)NC(NCCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H19Cl3N2O/c20-19(21,22)18(23-14-13-16-9-5-2-6-10-16)24-17(25)12-11-15-7-3-1-4-8-15/h1-12,18,23H,13-14H2,(H,24,25)/b12-11- |
| InChIKey | NFHKAOGAFMLRNQ-QXMHVHEDSA-N |
| XLogP | 4.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.73 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|