C17H21Cl3N2O — CID 3096947
3-phenyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]prop-2-enamide (PubChem CID 3096947) has the molecular formula C17H21Cl3N2O and a molecular weight of 375.73 g/mol. Its IUPAC name is 3-phenyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]prop-2-enamide.
| Compound Name | 3-phenyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 3096947 |
| Molecular Formula | C17H21Cl3N2O |
| Molecular Weight | 375.73 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 3-phenyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)NC(NC1CCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H21Cl3N2O/c18-17(19,20)16(21-14-9-5-2-6-10-14)22-15(23)12-11-13-7-3-1-4-8-13/h1,3-4,7-8,11-12,14,16,21H,2,5-6,9-10H2,(H,22,23) |
| InChIKey | MXDFEARPGGHAJN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.73 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|