C21H27Cl3N4OS — CID 178128725
(E)-N-[1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-8-ylcarbamothioylamino)-2,2,2-trichloroethyl]-3-phenylprop-2-enamide (PubChem CID 178128725) has the molecular formula C21H27Cl3N4OS and a molecular weight of 489.90 g/mol. Its IUPAC name is (E)-N-[1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-8-ylcarbamothioylamino)-2,2,2-trichloroethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-8-ylcarbamothioylamino)-2,2,2-trichloroethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 178128725 |
| Molecular Formula | C21H27Cl3N4OS |
| Molecular Weight | 489.90 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (E)-N-[1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-8-ylcarbamothioylamino)-2,2,2-trichloroethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(NC(=S)NC1CCCC2CCCNC21)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H27Cl3N4OS/c22-21(23,24)19(27-17(29)12-11-14-6-2-1-3-7-14)28-20(30)26-16-10-4-8-15-9-5-13-25-18(15)16/h1-3,6-7,11-12,15-16,18-19,25H,4-5,8-10,13H2,(H,27,29)(H2,26,28,30)/b12-11+ |
| InChIKey | MAPJVACKRYQGRO-VAWYXSNFSA-N |
| XLogP | 3.90 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.90 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|