C16H18Cl3N7OS — CID 135503498
(E)-3-phenyl-N-[2,2,2-trichloro-1-[[(Z)-(2-cyclopropyltetrazolidin-5-ylidene)carbamothioyl]amino]ethyl]prop-2-enamide (PubChem CID 135503498) has the molecular formula C16H18Cl3N7OS and a molecular weight of 462.79 g/mol. Its IUPAC name is (E)-3-phenyl-N-[2,2,2-trichloro-1-[[(Z)-(2-cyclopropyltetrazolidin-5-ylidene)carbamothioyl]amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[2,2,2-trichloro-1-[[(Z)-(2-cyclopropyltetrazolidin-5-ylidene)carbamothioyl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 135503498 |
| Molecular Formula | C16H18Cl3N7OS |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | (E)-3-phenyl-N-[2,2,2-trichloro-1-[[(Z)-(2-cyclopropyltetrazolidin-5-ylidene)carbamothioyl]amino]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(NC(=S)/N=C1/NNN(C2CC2)N1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H18Cl3N7OS/c17-16(18,19)13(20-12(27)9-6-10-4-2-1-3-5-10)21-15(28)22-14-23-25-26(24-14)11-7-8-11/h1-6,9,11,13,25H,7-8H2,(H,20,27)(H3,21,22,23,24,28)/b9-6+ |
| InChIKey | NAPKKKCFZHUMPL-RMKNXTFCSA-N |
| XLogP | 1.73 |
| TPSA | 92.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|