About S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate
S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate (PubChem CID 123188494) has the molecular formula C18H20BrNO3S
and a molecular weight of 410.33 g/mol. Its IUPAC name is S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate.
Molecular Properties
| Compound Name | S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate |
| PubChem CID | 123188494 |
| Molecular Formula | C18H20BrNO3S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate |
| SMILES | CC(=O)NCCSC(=O)CC(=O)C(C)=CC=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C18H20BrNO3S/c1-13(5-3-6-15-7-4-8-16(19)11-15)17(22)12-18(23)24-10-9-20-14(2)21/h3-8,11H,9-10,12H2,1-2H3,(H,20,21) |
| InChIKey | YSPKMPLXVNAGIE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate?
The IUPAC name of S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate (CID 123188494) is S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate.
What is the SMILES notation for S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate?
The canonical SMILES for S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate is CC(=O)NCCSC(=O)CC(=O)C(C)=CC=Cc1cccc(Br)c1.
What is the InChIKey of S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate?
The InChIKey is YSPKMPLXVNAGIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BrNO3S/c1-13(5-3-6-15-7-4-8-16(19)11-15)17(22)12-18(23)24-10-9-20-14(2)21/h3-8,11H,9-10,12H2,1-2H3,(H,20,21).
What are the key properties of S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate?
S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate has a molecular weight of 410.33 g/mol, XLogP of 3.76, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-acetamidoethyl) 7-(3-bromophenyl)-4-methyl-3-oxohepta-4,6-dienethioate is sourced from PubChem (CID 123188494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).