C19H23NO3S — CID 123176976
S-(2-acetamidoethyl) 4-ethyl-3-oxo-7-phenylhepta-4,6-dienethioate (PubChem CID 123176976) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is S-(2-acetamidoethyl) 4-ethyl-3-oxo-7-phenylhepta-4,6-dienethioate.
| Compound Name | S-(2-acetamidoethyl) 4-ethyl-3-oxo-7-phenylhepta-4,6-dienethioate |
|---|---|
| PubChem CID | 123176976 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | S-(2-acetamidoethyl) 4-ethyl-3-oxo-7-phenylhepta-4,6-dienethioate |
| SMILES | CCC(=CC=Cc1ccccc1)C(=O)CC(=O)SCCNC(C)=O |
| InChI | InChI=1S/C19H23NO3S/c1-3-17(11-7-10-16-8-5-4-6-9-16)18(22)14-19(23)24-13-12-20-15(2)21/h4-11H,3,12-14H2,1-2H3,(H,20,21) |
| InChIKey | IYGBDZKBPLNPNV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|