C22H24O7 — CID 87608070
(Z)-but-2-enedioic acid;2-methylidenebutanoyl 2-ethyl-5-phenylpenta-2,4-dienoate (PubChem CID 87608070) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-methylidenebutanoyl 2-ethyl-5-phenylpenta-2,4-dienoate.
| Compound Name | (Z)-but-2-enedioic acid;2-methylidenebutanoyl 2-ethyl-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 87608070 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-methylidenebutanoyl 2-ethyl-5-phenylpenta-2,4-dienoate |
| SMILES | C=C(CC)C(=O)OC(=O)C(=CC=Cc1ccccc1)CC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H20O3.C4H4O4/c1-4-14(3)17(19)21-18(20)16(5-2)13-9-12-15-10-7-6-8-11-15;5-3(6)1-2-4(7)8/h6-13H,3-5H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | BACQFSVWYPJBKR-BTJKTKAUSA-N |
| XLogP | 3.78 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|