C27H22O6 — CID 173322908
bis(5-phenylpenta-2,4-dienoyl) 2-methylidenebutanedioate (PubChem CID 173322908) has the molecular formula C27H22O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is bis(5-phenylpenta-2,4-dienoyl) 2-methylidenebutanedioate.
| Compound Name | bis(5-phenylpenta-2,4-dienoyl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 173322908 |
| Molecular Formula | C27H22O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | bis(5-phenylpenta-2,4-dienoyl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC(=O)C=CC=Cc1ccccc1)C(=O)OC(=O)C=CC=Cc1ccccc1 |
| InChI | InChI=1S/C27H22O6/c1-21(27(31)33-25(29)19-11-9-17-23-14-6-3-7-15-23)20-26(30)32-24(28)18-10-8-16-22-12-4-2-5-13-22/h2-19H,1,20H2 |
| InChIKey | NDTSCXDFLJKGQL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|