C23H27NO2 — CID 91577594
N-[2-(2,5-diphenylpenta-2,4-dienoxy)ethyl]butanamide (PubChem CID 91577594) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is N-[2-(2,5-diphenylpenta-2,4-dienoxy)ethyl]butanamide.
| Compound Name | N-[2-(2,5-diphenylpenta-2,4-dienoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 91577594 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N-[2-(2,5-diphenylpenta-2,4-dienoxy)ethyl]butanamide |
| SMILES | CCCC(=O)NCCOCC(=CC=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27NO2/c1-2-10-23(25)24-17-18-26-19-22(21-14-7-4-8-15-21)16-9-13-20-11-5-3-6-12-20/h3-9,11-16H,2,10,17-19H2,1H3,(H,24,25) |
| InChIKey | ZHQAYONRRBEKSU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|