C21H23N2O5P — CID 15449181
(E,E)-N-[(E)-1-diethoxyphosphoryl-2-(4-nitrophenyl)ethenyl]-3-phenylprop-2-en-1-imine (PubChem CID 15449181) has the molecular formula C21H23N2O5P and a molecular weight of 414.40 g/mol. Its IUPAC name is (E,E)-N-[(E)-1-diethoxyphosphoryl-2-(4-nitrophenyl)ethenyl]-3-phenylprop-2-en-1-imine.
| Compound Name | (E,E)-N-[(E)-1-diethoxyphosphoryl-2-(4-nitrophenyl)ethenyl]-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 15449181 |
| Molecular Formula | C21H23N2O5P |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (E,E)-N-[(E)-1-diethoxyphosphoryl-2-(4-nitrophenyl)ethenyl]-3-phenylprop-2-en-1-imine |
| SMILES | CCOP(=O)(OCC)C(=C/c1ccc([N+](=O)[O-])cc1)/N=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H23N2O5P/c1-3-27-29(26,28-4-2)21(17-19-12-14-20(15-13-19)23(24)25)22-16-8-11-18-9-6-5-7-10-18/h5-17H,3-4H2,1-2H3/b11-8+,21-17+,22-16+ |
| InChIKey | PNVCXNJIRGWCFV-HPUZHNQVSA-N |
| XLogP | 5.94 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|