C24H32NO4P — CID 11350883
N-[(2E)-2-(diethoxyphosphorylmethylidene)-1-phenylhexyl]benzamide (PubChem CID 11350883) has the molecular formula C24H32NO4P and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[(2E)-2-(diethoxyphosphorylmethylidene)-1-phenylhexyl]benzamide.
| Compound Name | N-[(2E)-2-(diethoxyphosphorylmethylidene)-1-phenylhexyl]benzamide |
|---|---|
| PubChem CID | 11350883 |
| Molecular Formula | C24H32NO4P |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[(2E)-2-(diethoxyphosphorylmethylidene)-1-phenylhexyl]benzamide |
| SMILES | CCCC/C(=C\P(=O)(OCC)OCC)C(NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32NO4P/c1-4-7-14-22(19-30(27,28-5-2)29-6-3)23(20-15-10-8-11-16-20)25-24(26)21-17-12-9-13-18-21/h8-13,15-19,23H,4-7,14H2,1-3H3,(H,25,26)/b22-19+ |
| InChIKey | YZRLEKPAKNXUBN-ZBJSNUHESA-N |
| XLogP | 6.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|