C26H17Cl2O3P — CID 90027519
(2,4-dichloro-3-diphenylphosphorylcarbonylphenyl)-phenylmethanone (PubChem CID 90027519) has the molecular formula C26H17Cl2O3P and a molecular weight of 479.30 g/mol. Its IUPAC name is (2,4-dichloro-3-diphenylphosphorylcarbonylphenyl)-phenylmethanone.
| Compound Name | (2,4-dichloro-3-diphenylphosphorylcarbonylphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 90027519 |
| Molecular Formula | C26H17Cl2O3P |
| Molecular Weight | 479.30 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | (2,4-dichloro-3-diphenylphosphorylcarbonylphenyl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(Cl)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c1Cl |
| InChI | InChI=1S/C26H17Cl2O3P/c27-22-17-16-21(25(29)18-10-4-1-5-11-18)24(28)23(22)26(30)32(31,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H |
| InChIKey | ODRWLFROZPCDHH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.30 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|