C41H41O4P — CID 175439396
diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone;[2-(1-hydroxycyclohexyl)phenyl]-phenylmethanone (PubChem CID 175439396) has the molecular formula C41H41O4P and a molecular weight of 628.75 g/mol. Its IUPAC name is diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone;[2-(1-hydroxycyclohexyl)phenyl]-phenylmethanone.
| Compound Name | diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone;[2-(1-hydroxycyclohexyl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 175439396 |
| Molecular Formula | C41H41O4P |
| Molecular Weight | 628.75 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone;[2-(1-hydroxycyclohexyl)phenyl]-phenylmethanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1.O=C(c1ccccc1)c1ccccc1C1(O)CCCCC1 |
| InChI | InChI=1S/C22H21O2P.C19H20O2/c1-16-14-17(2)21(18(3)15-16)22(23)25(24,19-10-6-4-7-11-19)20-12-8-5-9-13-20;20-18(15-9-3-1-4-10-15)16-11-5-6-12-17(16)19(21)13-7-2-8-14-19/h4-15H,1-3H3;1,3-6,9-12,21H,2,7-8,13-14H2 |
| InChIKey | WFEUGRXWQHCGEL-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.75 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|