C21H17Cl2O4P — CID 18400312
bis(4-methoxyphenyl)phosphoryl-(2,6-dichlorophenyl)methanone (PubChem CID 18400312) has the molecular formula C21H17Cl2O4P and a molecular weight of 435.24 g/mol. Its IUPAC name is bis(4-methoxyphenyl)phosphoryl-(2,6-dichlorophenyl)methanone.
| Compound Name | bis(4-methoxyphenyl)phosphoryl-(2,6-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 18400312 |
| Molecular Formula | C21H17Cl2O4P |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | bis(4-methoxyphenyl)phosphoryl-(2,6-dichlorophenyl)methanone |
| SMILES | COc1ccc(P(=O)(C(=O)c2c(Cl)cccc2Cl)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H17Cl2O4P/c1-26-14-6-10-16(11-7-14)28(25,17-12-8-15(27-2)9-13-17)21(24)20-18(22)4-3-5-19(20)23/h3-13H,1-2H3 |
| InChIKey | IMZVRNIJXQWOCD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|