C23H25O2P — CID 146792739
[(3-methylcyclohexa-1,5-dien-1-yl)-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 146792739) has the molecular formula C23H25O2P and a molecular weight of 364.43 g/mol. Its IUPAC name is [(3-methylcyclohexa-1,5-dien-1-yl)-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [(3-methylcyclohexa-1,5-dien-1-yl)-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 146792739 |
| Molecular Formula | C23H25O2P |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [(3-methylcyclohexa-1,5-dien-1-yl)-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(C2=CC(C)CC=C2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H25O2P/c1-16-9-8-12-21(15-16)26(25,20-10-6-5-7-11-20)23(24)22-18(3)13-17(2)14-19(22)4/h5-8,10-16H,9H2,1-4H3 |
| InChIKey | RWDRZBULRCEPSO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|