C26H26O9P+ — CID 173245628
oxo-(2,4,6-trimethoxybenzoyl)-[2-(2,3,6-trimethoxybenzoyl)phenyl]phosphanium (PubChem CID 173245628) has the molecular formula C26H26O9P+ and a molecular weight of 513.46 g/mol. Its IUPAC name is oxo-(2,4,6-trimethoxybenzoyl)-[2-(2,3,6-trimethoxybenzoyl)phenyl]phosphanium.
| Compound Name | oxo-(2,4,6-trimethoxybenzoyl)-[2-(2,3,6-trimethoxybenzoyl)phenyl]phosphanium |
|---|---|
| PubChem CID | 173245628 |
| Molecular Formula | C26H26O9P+ |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | oxo-(2,4,6-trimethoxybenzoyl)-[2-(2,3,6-trimethoxybenzoyl)phenyl]phosphanium |
| SMILES | COc1cc(OC)c(C(=O)[P+](=O)c2ccccc2C(=O)c2c(OC)ccc(OC)c2OC)c(OC)c1 |
| InChI | InChI=1S/C26H26O9P/c1-30-15-13-19(33-4)22(20(14-15)34-5)26(28)36(29)21-10-8-7-9-16(21)24(27)23-17(31-2)11-12-18(32-3)25(23)35-6/h7-14H,1-6H3/q+1 |
| InChIKey | VZNPHBHREJBZEC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|