C16H14Cl2O2P+ — CID 173245703
[2-(2,6-dichlorobenzoyl)phenyl]-oxo-propan-2-ylphosphanium (PubChem CID 173245703) has the molecular formula C16H14Cl2O2P+ and a molecular weight of 340.17 g/mol. Its IUPAC name is [2-(2,6-dichlorobenzoyl)phenyl]-oxo-propan-2-ylphosphanium.
| Compound Name | [2-(2,6-dichlorobenzoyl)phenyl]-oxo-propan-2-ylphosphanium |
|---|---|
| PubChem CID | 173245703 |
| Molecular Formula | C16H14Cl2O2P+ |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | [2-(2,6-dichlorobenzoyl)phenyl]-oxo-propan-2-ylphosphanium |
| SMILES | CC(C)[P+](=O)c1ccccc1C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H14Cl2O2P/c1-10(2)21(20)14-9-4-3-6-11(14)16(19)15-12(17)7-5-8-13(15)18/h3-10H,1-2H3/q+1 |
| InChIKey | BBSOZUHWVAUOTM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|