C22H27ClO3P+ — CID 70014987
[2-(2-chloro-6-methoxybenzoyl)phenyl]-(2-ethylhexyl)-oxophosphanium (PubChem CID 70014987) has the molecular formula C22H27ClO3P+ and a molecular weight of 405.88 g/mol. Its IUPAC name is [2-(2-chloro-6-methoxybenzoyl)phenyl]-(2-ethylhexyl)-oxophosphanium.
| Compound Name | [2-(2-chloro-6-methoxybenzoyl)phenyl]-(2-ethylhexyl)-oxophosphanium |
|---|---|
| PubChem CID | 70014987 |
| Molecular Formula | C22H27ClO3P+ |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [2-(2-chloro-6-methoxybenzoyl)phenyl]-(2-ethylhexyl)-oxophosphanium |
| SMILES | CCCCC(CC)C[P+](=O)c1ccccc1C(=O)c1c(Cl)cccc1OC |
| InChI | InChI=1S/C22H27ClO3P/c1-4-6-10-16(5-2)15-27(25)20-14-8-7-11-17(20)22(24)21-18(23)12-9-13-19(21)26-3/h7-9,11-14,16H,4-6,10,15H2,1-3H3/q+1 |
| InChIKey | FOBUXVQSWPTPBA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|