C16H25ClO2 — CID 104817350
1-(2-chloro-6-methoxyphenyl)-3-ethylheptan-1-ol (PubChem CID 104817350) has the molecular formula C16H25ClO2 and a molecular weight of 284.83 g/mol. Its IUPAC name is 1-(2-chloro-6-methoxyphenyl)-3-ethylheptan-1-ol.
| Compound Name | 1-(2-chloro-6-methoxyphenyl)-3-ethylheptan-1-ol |
|---|---|
| PubChem CID | 104817350 |
| Molecular Formula | C16H25ClO2 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-(2-chloro-6-methoxyphenyl)-3-ethylheptan-1-ol |
| SMILES | CCCCC(CC)CC(O)c1c(Cl)cccc1OC |
| InChI | InChI=1S/C16H25ClO2/c1-4-6-8-12(5-2)11-14(18)16-13(17)9-7-10-15(16)19-3/h7,9-10,12,14,18H,4-6,8,11H2,1-3H3 |
| InChIKey | YBUVPGJCWVFROV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |