C24H17ClO2 — CID 134835220
(2-chlorophenyl)-(5-methyl-2,4-diphenylfuran-3-yl)methanone (PubChem CID 134835220) has the molecular formula C24H17ClO2 and a molecular weight of 372.85 g/mol. Its IUPAC name is (2-chlorophenyl)-(5-methyl-2,4-diphenylfuran-3-yl)methanone.
| Compound Name | (2-chlorophenyl)-(5-methyl-2,4-diphenylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 134835220 |
| Molecular Formula | C24H17ClO2 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (2-chlorophenyl)-(5-methyl-2,4-diphenylfuran-3-yl)methanone |
| SMILES | Cc1oc(-c2ccccc2)c(C(=O)c2ccccc2Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C24H17ClO2/c1-16-21(17-10-4-2-5-11-17)22(23(26)19-14-8-9-15-20(19)25)24(27-16)18-12-6-3-7-13-18/h2-15H,1H3 |
| InChIKey | YKVYGBZSCKFQMK-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |