C20H21ClO2 — CID 83954326
(Z)-3-(4-tert-butylphenyl)-2-(3-chloro-4-methylphenyl)prop-2-enoic acid (PubChem CID 83954326) has the molecular formula C20H21ClO2 and a molecular weight of 328.84 g/mol. Its IUPAC name is (Z)-3-(4-tert-butylphenyl)-2-(3-chloro-4-methylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(4-tert-butylphenyl)-2-(3-chloro-4-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83954326 |
| Molecular Formula | C20H21ClO2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (Z)-3-(4-tert-butylphenyl)-2-(3-chloro-4-methylphenyl)prop-2-enoic acid |
| SMILES | Cc1ccc(/C(=C/c2ccc(C(C)(C)C)cc2)C(=O)O)cc1Cl |
| InChI | InChI=1S/C20H21ClO2/c1-13-5-8-15(12-18(13)21)17(19(22)23)11-14-6-9-16(10-7-14)20(2,3)4/h5-12H,1-4H3,(H,22,23)/b17-11- |
| InChIKey | FHCZSILUFQWSLV-BOPFTXTBSA-N |
| XLogP | 5.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|