C18H20ClNO2S — CID 134920855
4-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-N,N-diethylaniline (PubChem CID 134920855) has the molecular formula C18H20ClNO2S and a molecular weight of 349.88 g/mol. Its IUPAC name is 4-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 134920855 |
| Molecular Formula | C18H20ClNO2S |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-[(Z)-2-(benzenesulfonyl)-2-chloroethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=C(\Cl)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H20ClNO2S/c1-3-20(4-2)16-12-10-15(11-13-16)14-18(19)23(21,22)17-8-6-5-7-9-17/h5-14H,3-4H2,1-2H3/b18-14+ |
| InChIKey | ZEXJZTPPHGVZFK-NBVRZTHBSA-N |
| XLogP | 4.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|