C20H20ClN3O — CID 8727097
4-[(Z)-2-chloro-2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethenyl]-N,N-diethylaniline (PubChem CID 8727097) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is 4-[(Z)-2-chloro-2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(Z)-2-chloro-2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 8727097 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-[(Z)-2-chloro-2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=C(\Cl)c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C20H20ClN3O/c1-3-24(4-2)17-12-10-15(11-13-17)14-18(21)20-23-22-19(25-20)16-8-6-5-7-9-16/h5-14H,3-4H2,1-2H3/b18-14- |
| InChIKey | UIQUQDZSEMQKTI-JXAWBTAJSA-N |
| XLogP | 5.32 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|