C12H15N3O — CID 24304
N,N-diethyl-5-phenyl-1,3,4-oxadiazol-2-amine (PubChem CID 24304) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is N,N-diethyl-5-phenyl-1,3,4-oxadiazol-2-amine.
| Compound Name | N,N-diethyl-5-phenyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 24304 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N,N-diethyl-5-phenyl-1,3,4-oxadiazol-2-amine |
| SMILES | CCN(CC)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C12H15N3O/c1-3-15(4-2)12-14-13-11(16-12)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | MRXYSWDEIZTLGG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |