C20H17ClN2O3 — CID 9447353
2-[(Z)-1-chloro-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 9447353) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[(Z)-1-chloro-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 9447353 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | C=CCOc1ccc(/C=C(\Cl)c2nnc(-c3ccccc3)o2)cc1OC |
| InChI | InChI=1S/C20H17ClN2O3/c1-3-11-25-17-10-9-14(13-18(17)24-2)12-16(21)20-23-22-19(26-20)15-7-5-4-6-8-15/h3-10,12-13H,1,11H2,2H3/b16-12- |
| InChIKey | CCBACGNKNMNUFD-VBKFSLOCSA-N |
| XLogP | 5.05 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|