C20H16ClNO4 — CID 9035122
2-[(Z)-1-chloro-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-3,1-benzoxazin-4-one (PubChem CID 9035122) has the molecular formula C20H16ClNO4 and a molecular weight of 369.80 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-3,1-benzoxazin-4-one.
| Compound Name | 2-[(Z)-1-chloro-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 9035122 |
| Molecular Formula | C20H16ClNO4 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]-3,1-benzoxazin-4-one |
| SMILES | C=CCOc1ccc(/C=C(\Cl)c2nc3ccccc3c(=O)o2)cc1OC |
| InChI | InChI=1S/C20H16ClNO4/c1-3-10-25-17-9-8-13(12-18(17)24-2)11-15(21)19-22-16-7-5-4-6-14(16)20(23)26-19/h3-9,11-12H,1,10H2,2H3/b15-11- |
| InChIKey | MYFBZMURDGVZLF-PTNGSMBKSA-N |
| XLogP | 4.50 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|