C21H18NO4S2- — CID 9035959
2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]sulfanylacetate (PubChem CID 9035959) has the molecular formula C21H18NO4S2- and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]sulfanylacetate.
| Compound Name | 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]sulfanylacetate |
|---|---|
| PubChem CID | 9035959 |
| Molecular Formula | C21H18NO4S2- |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(3-methoxy-4-prop-2-enoxyphenyl)ethenyl]sulfanylacetate |
| SMILES | C=CCOc1ccc(/C=C(\SCC(=O)[O-])c2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C21H19NO4S2/c1-3-10-26-16-9-8-14(11-17(16)25-2)12-19(27-13-20(23)24)21-22-15-6-4-5-7-18(15)28-21/h3-9,11-12H,1,10,13H2,2H3,(H,23,24)/p-1/b19-12- |
| InChIKey | HZWFKQGQEOEWSG-UNOMPAQXSA-M |
| XLogP | 3.85 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|