About 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene
4-(diethylamino)benzaldehyde;phenylsulfanylbenzene (PubChem CID 172832620) has the molecular formula C23H25NOS
and a molecular weight of 363.53 g/mol. Its IUPAC name is 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene.
Molecular Properties
| Compound Name | 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene |
| PubChem CID | 172832620 |
| Molecular Formula | C23H25NOS |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene |
| SMILES | CCN(CC)c1ccc(C=O)cc1.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C11H15NO/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-12(4-2)11-7-5-10(9-13)6-8-11/h1-10H;5-9H,3-4H2,1-2H3 |
| InChIKey | VSGFYABZMFNLGA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene?
The IUPAC name of 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene (CID 172832620) is 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene.
What is the SMILES notation for 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene?
The canonical SMILES for 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene is CCN(CC)c1ccc(C=O)cc1.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene?
The InChIKey is VSGFYABZMFNLGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.C11H15NO/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-12(4-2)11-7-5-10(9-13)6-8-11/h1-10H;5-9H,3-4H2,1-2H3.
What are the key properties of 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene?
4-(diethylamino)benzaldehyde;phenylsulfanylbenzene has a molecular weight of 363.53 g/mol, XLogP of 6.18, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)benzaldehyde;phenylsulfanylbenzene is sourced from PubChem (CID 172832620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).