C22H24BrN3O — CID 126239276
(Z)-3-[3-bromo-4-(diethylamino)phenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 126239276) has the molecular formula C22H24BrN3O and a molecular weight of 426.36 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-(diethylamino)phenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-(diethylamino)phenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126239276 |
| Molecular Formula | C22H24BrN3O |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (Z)-3-[3-bromo-4-(diethylamino)phenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)cc1Br |
| InChI | InChI=1S/C22H24BrN3O/c1-4-26(5-2)21-12-11-17(14-20(21)23)13-19(15-24)22(27)25-16(3)18-9-7-6-8-10-18/h6-14,16H,4-5H2,1-3H3,(H,25,27)/b19-13-/t16-/m0/s1 |
| InChIKey | JXPKDRFRDCRNRU-UEIJICEPSA-N |
| XLogP | 5.08 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|