C25H22F2N2O3 — CID 22829983
N,N'-dibenzyl-2-[[4-(difluoromethoxy)phenyl]methylidene]propanediamide (PubChem CID 22829983) has the molecular formula C25H22F2N2O3 and a molecular weight of 436.46 g/mol. Its IUPAC name is N,N'-dibenzyl-2-[[4-(difluoromethoxy)phenyl]methylidene]propanediamide.
| Compound Name | N,N'-dibenzyl-2-[[4-(difluoromethoxy)phenyl]methylidene]propanediamide |
|---|---|
| PubChem CID | 22829983 |
| Molecular Formula | C25H22F2N2O3 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N,N'-dibenzyl-2-[[4-(difluoromethoxy)phenyl]methylidene]propanediamide |
| SMILES | O=C(NCc1ccccc1)C(=Cc1ccc(OC(F)F)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H22F2N2O3/c26-25(27)32-21-13-11-18(12-14-21)15-22(23(30)28-16-19-7-3-1-4-8-19)24(31)29-17-20-9-5-2-6-10-20/h1-15,25H,16-17H2,(H,28,30)(H,29,31) |
| InChIKey | QUKUKQFFIJPCNT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|