C15H13BrN2O5 — CID 129396730
N-[(Z)-(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-3,5-dihydroxybenzamide (PubChem CID 129396730) has the molecular formula C15H13BrN2O5 and a molecular weight of 381.18 g/mol. Its IUPAC name is N-[(Z)-(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-3,5-dihydroxybenzamide.
| Compound Name | N-[(Z)-(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 129396730 |
| Molecular Formula | C15H13BrN2O5 |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | N-[(Z)-(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-3,5-dihydroxybenzamide |
| SMILES | COc1cc(Br)c(/C=N\NC(=O)c2cc(O)cc(O)c2)cc1O |
| InChI | InChI=1S/C15H13BrN2O5/c1-23-14-6-12(16)9(4-13(14)21)7-17-18-15(22)8-2-10(19)5-11(20)3-8/h2-7,19-21H,1H3,(H,18,22)/b17-7- |
| InChIKey | IBMPDDOSHSEPNU-IDUWFGFVSA-N |
| XLogP | 2.34 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|