C13H13Br2N5O3 — CID 5074141
4-amino-N-[(3,5-dibromo-2-propan-2-yloxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 5074141) has the molecular formula C13H13Br2N5O3 and a molecular weight of 447.09 g/mol. Its IUPAC name is 4-amino-N-[(3,5-dibromo-2-propan-2-yloxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[(3,5-dibromo-2-propan-2-yloxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 5074141 |
| Molecular Formula | C13H13Br2N5O3 |
| Molecular Weight | 447.09 g/mol |
| Exact Mass | 444.94 |
| IUPAC Name | 4-amino-N-[(3,5-dibromo-2-propan-2-yloxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | CC(C)Oc1c(Br)cc(Br)cc1C=NNC(=O)c1nonc1N |
| InChI | InChI=1S/C13H13Br2N5O3/c1-6(2)22-11-7(3-8(14)4-9(11)15)5-17-18-13(21)10-12(16)20-23-19-10/h3-6H,1-2H3,(H2,16,20)(H,18,21) |
| InChIKey | GTKUZBWQIVLGNY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|