C19H14BrN3O4 — CID 135651442
4-bromo-N-[(E)-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methylideneamino]benzamide (PubChem CID 135651442) has the molecular formula C19H14BrN3O4 and a molecular weight of 428.24 g/mol. Its IUPAC name is 4-bromo-N-[(E)-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methylideneamino]benzamide.
| Compound Name | 4-bromo-N-[(E)-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135651442 |
| Molecular Formula | C19H14BrN3O4 |
| Molecular Weight | 428.24 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 4-bromo-N-[(E)-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc2cc3c(cc2[nH]c1=O)OCCO3)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H14BrN3O4/c20-14-3-1-11(2-4-14)19(25)23-21-10-13-7-12-8-16-17(27-6-5-26-16)9-15(12)22-18(13)24/h1-4,7-10H,5-6H2,(H,22,24)(H,23,25)/b21-10+ |
| InChIKey | FMGICUAXNUVDOZ-UFFVCSGVSA-N |
| XLogP | 2.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|